![2-{[2-(3,4-Dimethoxyphenyl)ethyl]carbamoyl}benzoic acid structure](/static/products/1017/101730-66-9.webp)
2-{[2-(3,4-Dimethoxyphenyl)ethyl]carbamoyl}benzoic acid
2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]benzoic acid
Also Known As: starbld0027298|Oprea1_442184|Oprea1_478608|2-{[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl}benzoic acid|BAS 00821013|2-((3,4-Dimethoxyphenethyl)carbamoyl)benzoic acid|2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]benzoic acid|N-[2-(3,4-Dimethoxy-phenyl)-ethyl]-phthalamic acid|AS-662/36521017|SR-01000356804-1|2-({[2-(3,4-dimethoxyphenyl)ethyl]amino}carbonyl)benzoic acid
| Molecular Formula | C18H19NO5 |
|---|---|
| Molecular Weight | 329.1263 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 84.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 329.1263 |
| Monoisotopic Mass | 329.1263 |
| Heavy Atoms | 24 |
| Complexity | 428.0 |
Chemical Identifiers
| CAS Number | 101730-66-9 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)CCNC(=O)C2=CC=CC=C2C(=O)O)OC |
| InChIKey | VVCMUAMIHKGLDJ-UHFFFAOYSA-N |
Product Overview
2-{[2-(3,4-Dimethoxyphenyl)ethyl]carbamoyl}benzoic acid (CAS 101730-66-9), with molecular formula C18H19NO5 and molecular weight 329.1263 g/mol. IUPAC: 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]benzoic acid.
2-{[2-(3,4-Dimethoxyphenyl)ethyl]carbamoyl}benzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »