Silane, 1,4-naphthalenediylbis(trimethyl-
trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane
Also Known As: Silane, 1,4-naphthalenediylbis(trimethyl-|1,4-bis(trimethylsilyl)naphthalene|1.4-Bis(trimethylsilyl)naphthalin|Naphthalene, 1,4-bis(trimethylsilyl)-|1,4-bis(trimethylsilyl)-naphthalene|trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane|(Naphthalene-1,4-diyl)bis(trimethylsilane)|Silane, 1,4-naphthalenediylbis[trimethyl-]-|J2.146.242J|TRIMETHYL[4-(TRIMETHYLSILYL)NAPHTHALEN-1-YL]SILANE
| Molecular Formula | C16H24Si2 |
|---|---|
| Molecular Weight | 272.14166 g/mol |
| LogP | 3.9302 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 272.14166 |
| Monoisotopic Mass | 272.14166 |
| Heavy Atoms | 18 |
| Complexity | 254.0 |
Chemical Identifiers
| CAS Number | 1024-47-1 |
|---|---|
| SMILES | C[Si](C)(C)C1=CC=C(C2=CC=CC=C21)[Si](C)(C)C |
| InChIKey | HAHFMUUKMOXSTI-UHFFFAOYSA-N |
Product Overview
Silane, 1,4-naphthalenediylbis(trimethyl- (CAS 1024-47-1), with molecular formula C16H24Si2 and molecular weight 272.14166 g/mol. IUPAC: trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane.
Silane, 1,4-naphthalenediylbis(trimethyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »