Ccris 3570
17-oxa-2-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1(14),2,4,6,8,10,12,15(21),22-nonaene-19,20-diol
Also Known As: Dibenz(a,h)acridine 3,4-diol-1,2-epoxide|anti-(+-)-1,2,3,4-Tetrahydrodibenz(a,h)acridine-3,4-diol-1,2-epoxide|( /-)-anti-Dibenz(a,h)acridine 3,4-diol-1,2-epoxide|(+/-)-anti-Dibenz(a,h)acridine 3,4-diol-1,2-epoxide|1a,2,3,13c-tetrahydrobenzo[h][1]benzoxireno[2,3-a]acridine-2,3-diol|ANTI-(+/-)-1,2,3,4-TETRAHYDRODIBENZ[A,H]ACRIDINE-3,4-DIOL-1,2-EPOXIDE|Benz(h)oxireno(5,6)benz(1,2-a)acridine-2,3-diol, 1a,2,3,13c-tetrahydro-, (1a-alpha,2-beta,3-alpha,13c-alpha)-(+-)-
| Molecular Formula | C21H15NO3 |
|---|---|
| Molecular Weight | 329.1052 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 65.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 329.1052 |
| Monoisotopic Mass | 329.1052 |
| Heavy Atoms | 25 |
| Complexity | 541.0 |
Chemical Identifiers
| CAS Number | 102421-85-2 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C=CC3=CC4=C(C=CC5=C4C6C(O6)C(C5O)O)N=C32 |
| InChIKey | XPMBTWVVTCOLCP-UHFFFAOYSA-N |
Product Overview
Ccris 3570 (CAS 102421-85-2), with molecular formula C21H15NO3 and molecular weight 329.1052 g/mol. IUPAC: 17-oxa-2-azahexacyclo[12.9.0.03,12.04,9.015,21.016,18]tricosa-1(14),2,4,6,8,10,12,15(21),22-nonaene-19,20-diol.