N-Butyl-4-methyl-N-(4-methylbenzene-1-sulfonyl)benzene-1-sulfonamide
N-butyl-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide
Also Known As: N,N-Ditosylbutylamine|N,N-Ditosyl-1-butanamine|J1.428.129K|N-Butyl-4-methyl-N-(4-methylbenzene-1-sulfonyl)benzene-1-sulfonamide|N-butyl-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamid|N-butyl-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide|N-butyl-4-methyl-N-(4-methylbenzenesulfonyl)benzene-1-sulfonamide
| Molecular Formula | C18H23NO4S2 |
|---|---|
| Molecular Weight | 381.10684 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 88.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 381.10684 |
| Monoisotopic Mass | 381.10684 |
| Heavy Atoms | 25 |
| Complexity | 550.0 |
Chemical Identifiers
| CAS Number | 10285-90-2 |
|---|---|
| SMILES | CCCCN(S(=O)(=O)C1=CC=C(C=C1)C)S(=O)(=O)C2=CC=C(C=C2)C |
| InChIKey | ZBJXVAJUIPZDJP-UHFFFAOYSA-N |
Product Overview
N-Butyl-4-methyl-N-(4-methylbenzene-1-sulfonyl)benzene-1-sulfonamide (CAS 10285-90-2), with molecular formula C18H23NO4S2 and molecular weight 381.10684 g/mol. IUPAC: N-butyl-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide.
N-Butyl-4-methyl-N-(4-methylbenzene-1-sulfonyl)benzene-1-sulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »