Silane, (cyclopropylcarbonyl)(1,1-dimethylethyl)dimethyl-
[tert-butyl(dimethyl)silyl]-cyclopropylmethanone
Also Known As: ACMC-20bebg|Silane, (cyclopropylcarbonyl)(1,1-dimethylethyl)dimethyl-|[tert-butyl(dimethyl)silyl]-cyclopropylmethanone|tert-Butyl(cyclopropylcarbonyl)dimethylsilane|tert-Butyl(cyclopropylcarbonyl)dimethylsilane #|[tert-Butyldi(methyl)silyl](cyclopropyl)methanone|tert-butyldimethylsilyloxomethylcyclopropylmethanone
| Molecular Formula | C10H20OSi |
|---|---|
| Molecular Weight | 184.12834 g/mol |
| LogP | 3.0132 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 184.12834 |
| Monoisotopic Mass | 184.12834 |
| Heavy Atoms | 12 |
| Complexity | 196.0 |
Chemical Identifiers
| CAS Number | 105875-66-9 |
|---|---|
| SMILES | CC(C)(C)[Si](C)(C)C(=O)C1CC1 |
| InChIKey | ITMBFNZCPVPDEL-UHFFFAOYSA-N |
Product Overview
Silane, (cyclopropylcarbonyl)(1,1-dimethylethyl)dimethyl- (CAS 105875-66-9), with molecular formula C10H20OSi and molecular weight 184.12834 g/mol. IUPAC: [tert-butyl(dimethyl)silyl]-cyclopropylmethanone.
Silane, (cyclopropylcarbonyl)(1,1-dimethylethyl)dimethyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »