![Methanone, phenyl[4-(1-piperidinyl)phenyl]- structure](/static/products/1069/106947-61-9.webp)
Methanone, phenyl[4-(1-piperidinyl)phenyl]-
phenyl-(4-piperidin-1-ylphenyl)methanone
Also Known As: 4-Piperidinobenzophenon|4-Piperidinobenzophenone|ACMC-20mas3|CBMicro_008906|Oprea1_735822|phenyl 4-piperidylphenyl ketone|phenyl[4-(1-piperidinyl)phenyl]methanone|phenyl-(4-piperidin-1-ylphenyl)methanone|Methanone, phenyl[4-(1-piperidinyl)phenyl]-|1-(4-BENZOYLPHENYL)PIPERIDINE|phenyl(4-(piperidin-1-yl)phenyl)methanone|BIM-0008902.P001|PHENYL(4-PIPERIDINOPHENYL)METHANONE|phenyl[4-(piperidin-1-yl)phenyl]methanone|SR-01000452781-1|A2502/0106456
| Molecular Formula | C18H19NO |
|---|---|
| Molecular Weight | 265.14667 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 20.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 265.14667 |
| Monoisotopic Mass | 265.14667 |
| Heavy Atoms | 20 |
| Complexity | 307.0 |
Chemical Identifiers
| CAS Number | 106947-61-9 |
|---|---|
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
| InChIKey | CSDZERXKCULLKS-UHFFFAOYSA-N |
Product Overview
Methanone, phenyl[4-(1-piperidinyl)phenyl]- (CAS 106947-61-9), with molecular formula C18H19NO and molecular weight 265.14667 g/mol. IUPAC: phenyl-(4-piperidin-1-ylphenyl)methanone.
Methanone, phenyl[4-(1-piperidinyl)phenyl]- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »