AC1L4FIK
3-chloro-2-[2,4-dichloro-5-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydroindazole
Also Known As: ACMC-20cb13|2h-indazole, 3-chloro-2-(2,4-dichloro-5-(difluoromethoxy)phenyl)-4,5,6,7-tetrahydro-|1-Pentadecanaminium,N,N,N-trimethyl-2-undecyl-,chloride|3-chloro-2-[2,4-dichloro-5-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-2h-indazole|2H-Indazole,3-chloro-2-[2,4-dichloro-5-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-|3-chloro-2-[2,4-dichloro-5-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydroindazole|3-Chloro-2-(2,4-dichloro-5-difluoromethoxyphenyl)-4,5,6,7-tetrahydro-2H-indazole
| Molecular Formula | C14H11Cl3F2N2O |
|---|---|
| Molecular Weight | 365.9905 g/mol |
| LogP | 6.3 |
| Topological Polar Surface Area | 27.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 365.9905 |
| Monoisotopic Mass | 365.9905 |
| Heavy Atoms | 22 |
| Complexity | 393.0 |
Chemical Identifiers
| CAS Number | 106969-02-2 |
|---|---|
| SMILES | C1CCC2=NN(C(=C2C1)Cl)C3=CC(=C(C=C3Cl)Cl)OC(F)F |
| InChIKey | ATZWGHLUWQSOKN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
AC1L4FIK (CAS 106969-02-2), with molecular formula C14H11Cl3F2N2O and molecular weight 365.9905 g/mol. IUPAC: 3-chloro-2-[2,4-dichloro-5-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydroindazole.