![4-[(2-Chloro-acetylamino)-methyl]-thiophene-2-carboxylic acid methyl ester structure](/static/products/107/107553-63-9.png)
4-[(2-Chloro-acetylamino)-methyl]-thiophene-2-carboxylic acid methyl ester
methyl 4-[[(2-chloroacetyl)amino]methyl]thiophene-2-carboxylate
Also Known As: BAS 00286379|SR-01000361224-1|4-[(2-Chloro-acetylamino)-methyl]-thiophene-2-carboxylic acid methyl ester|methyl 4-[[(2-chloroacetyl)amino]methyl]thiophene-2-carboxylate|methyl 4-((2-chloroacetamido)methyl)thiophene-2-carboxylate|methyl 4-{[(chloroacetyl)amino]methyl}thiophene-2-carboxylate|Methyl 4-([(chloroacetyl)amino]methyl)-2-thiophenecarboxylate #
| Molecular Formula | C9H10ClNO3S |
|---|---|
| Molecular Weight | 247.00699 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 83.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 247.00699 |
| Monoisotopic Mass | 247.00699 |
| Heavy Atoms | 15 |
| Complexity | 250.0 |
Chemical Identifiers
| CAS Number | 107553-63-9 |
|---|---|
| SMILES | COC(=O)C1=CC(=CS1)CNC(=O)CCl |
| InChIKey | IXCJUMIKWIRPDJ-UHFFFAOYSA-N |
Product Overview
4-[(2-Chloro-acetylamino)-methyl]-thiophene-2-carboxylic acid methyl ester (CAS 107553-63-9), with molecular formula C9H10ClNO3S and molecular weight 247.00699 g/mol. IUPAC: methyl 4-[[(2-chloroacetyl)amino]methyl]thiophene-2-carboxylate.
4-[(2-Chloro-acetylamino)-methyl]-thiophene-2-carboxylic acid methyl ester is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »