N-Methylhuperzine B
TL;DR: N-Methylhuperzine B (CAS 110037-64-4) is a chemical compound with molecular formula C17H22N2O and molecular weight 270.17322 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(1R,9R,10R)-14,16-dimethyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one
Also Known As: N-Methylhuperzine B, Lycodin-1(18H)-one, 8,15-didehydro-17-methyl-, Lycodin-1(18H)-one,8,15-didehydro-17-methyl, 1,12-Dimethyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8-ol, (1R,9R,10R)-14,16-dimethyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one
Technical Specifications
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.17322 g/mol |
| XLogP | 1.1 |
| Topological Polar Surface Area (TPSA) | 32.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 270.17322 Da |
| Heavy Atoms | 20 |
| Complexity | 572.0 |
| SMILES | CC1=C[C@H]2CC3=C(C=CC(=O)N3)[C@@]4(C1)[C@@H]2CCCN4C |
| InChIKey | JCINWKNLTDEYIA-OGHNNQOOSA-N |
Chemical Property Profile of N-Methylhuperzine B
Property Insights of N-Methylhuperzine B
The XLogP value of 1.1 suggests moderate lipophilicity, balancing water solubility and membrane permeability for N-Methylhuperzine B. With a topological polar surface area (TPSA) of 32.3 Ų, N-Methylhuperzine B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, N-Methylhuperzine B has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of N-Methylhuperzine B?
The CAS number of N-Methylhuperzine B is 110037-64-4.
What is the molecular formula of N-Methylhuperzine B?
The molecular formula of N-Methylhuperzine B is C17H22N2O.
What is the molecular weight of N-Methylhuperzine B?
The molecular weight of N-Methylhuperzine B is 270.17322 g/mol.
Where can I buy N-Methylhuperzine B?
You can request a quote for N-Methylhuperzine B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for N-Methylhuperzine B?
Yes, CoreyChem provides custom synthesis services for N-Methylhuperzine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.