3-Phenoxybenzyltriethylammonium
triethyl-[(3-phenoxyphenyl)methyl]azanium chloride
Also Known As: 3-Phenoxybenzyltriethylammonium|3-PBTEA|3-Phenoxybenzyltriethylamine hydrochloride|Triethyl(m-phenoxybenzyl)ammonium chloride|n,n-diethyl-n-(3-phenoxybenzyl)ethanaminium chloride|3-phenoxybenzyl triethyl ammonium chloride|Triethyl m-phenoxybenzyl ammonium chloride|3-phenoxybenzyl 3,3-dimethylpent-4-enoate|triethyl-[(3-phenoxyphenyl)methyl]azanium;chloride|((3-Phenoxyphenyl)methyl)-N,N,N-triethylammonium chloride|Benzenemethanaminium, N,N,N-triethyl-3-phenoxy-, chloride|TRIETHYL M-PHENOXYBENZYLAMMONIUM CHLORIDE|3-PHENOXYBENZYL-TRIETHYLAMMONIUM CHLORIDE|triethyl-[(3-phenoxyphenyl)methyl]azanium chloride|Ammonium, ((3-phenoxyphenyl)methyl)-N,N,N-triethyl-, chloride|N,N-Diethyl-N-[(3-phenoxyphenyl)methyl]ethanaminium chloride
| Molecular Formula | C19H26ClNO |
|---|---|
| Molecular Weight | 319.1703 g/mol |
| LogP | 1.8594 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Exact Mass | 319.1703 |
| Monoisotopic Mass | 319.1703 |
| Heavy Atoms | 22 |
| Complexity | 273.0 |
Chemical Identifiers
| CAS Number | 1101-08-2 |
|---|---|
| SMILES | CC[N+](CC)(CC)CC1=CC(=CC=C1)OC2=CC=CC=C2.[Cl-] |
| InChIKey | LDFPTHJERYPPKM-UHFFFAOYSA-M |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-Phenoxybenzyltriethylammonium (CAS 1101-08-2), with molecular formula C19H26ClNO and molecular weight 319.1703 g/mol. IUPAC: triethyl-[(3-phenoxyphenyl)methyl]azanium chloride.