Taxamairin B
TL;DR: Taxamairin B (CAS 110300-77-1) is a chemical compound with molecular formula C22H24O4 and molecular weight 352.16745 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
14,15-dimethoxy-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,4,8,11,13-hexaene-6,10-dione
Also Known As: Taxamairin B, Taxamairin-B, HY-N12042, 14,15-dimethoxy-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,4,8,11,13-hexaene-6,10-dione, 1,2-dimethoxy-7,7-dimethyl-3-propan-2-yldibenzo[2,4-d:4',5'-e][7]annulene-5,8-dione
Technical Specifications
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.16745 g/mol |
| XLogP | 3.8 |
| Topological Polar Surface Area (TPSA) | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 352.16745 Da |
| Heavy Atoms | 26 |
| Complexity | 695.0 |
| SMILES | CC(C)C1=C(C(=C2C=C3C=CC(=O)C(C3=CC(=O)C2=C1)(C)C)OC)OC |
| InChIKey | LDBQEVDAHSVWKL-UHFFFAOYSA-N |
Chemical Property Profile of Taxamairin B
Property Insights of Taxamairin B
The XLogP value of 3.8 indicates that Taxamairin B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 52.6 Ų, Taxamairin B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Taxamairin B has 0 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Taxamairin B?
The CAS number of Taxamairin B is 110300-77-1.
What is the molecular formula of Taxamairin B?
The molecular formula of Taxamairin B is C22H24O4.
What is the molecular weight of Taxamairin B?
The molecular weight of Taxamairin B is 352.16745 g/mol.
Where can I buy Taxamairin B?
You can request a quote for Taxamairin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Taxamairin B?
Yes, CoreyChem provides custom synthesis services for Taxamairin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.