Oligomycin B
TL;DR: Oligomycin B (CAS 11050-94-5) is a chemical compound with molecular formula C45H72O12 and molecular weight 804.5024 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(1S,5'R,6R,6'R,7S,8R,10S,11S,12R,14S,15R,16S,22S,25R,27R,28R,29S)-22-ethyl-7,11,14,15-tetrahydroxy-6'-[(2S)-2-hydroxypropyl]-5',6,8,10,12,14,16,28,29-nonamethylspiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-oxane]-3,3',9,13-tetrone
Also Known As: Oligomycin B
Technical Specifications
| Molecular Formula | C45H72O12 |
| Molecular Weight | 804.5024 g/mol |
| XLogP | 6.1 |
| Topological Polar Surface Area (TPSA) | 197.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Exact Mass | 804.5024 Da |
| Heavy Atoms | 57 |
| Complexity | 1470.0 |
| SMILES | CC[C@H]1CC[C@@H]2[C@@H]([C@@H]([C@H]([C@@]3(O2)C(=O)C[C@H]([C@H](O3)C[C@H](C)O)C)C)OC(=O)C=C[C@H]([C@@H]([C@H](C(=O)[C@H]([C@@H]([C@H](C(=O)[C@@]([C@@H]([C@H](CC=CC=C1)C)O)(C)O)C)O)C)C)O)C)C |
| InChIKey | QPRQJOHKNJIMGN-HFCHTRRZSA-N |
Chemical Property Profile of Oligomycin B
Property Insights of Oligomycin B
The XLogP value of 6.1 indicates that Oligomycin B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 197.0 Ų indicates high polarity, suggesting Oligomycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Oligomycin B has 5 hydrogen bond donor(s) and 12 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Oligomycin B?
The CAS number of Oligomycin B is 11050-94-5.
What is the molecular formula of Oligomycin B?
The molecular formula of Oligomycin B is C45H72O12.
What is the molecular weight of Oligomycin B?
The molecular weight of Oligomycin B is 804.5024 g/mol.
Where can I buy Oligomycin B?
You can request a quote for Oligomycin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Oligomycin B?
Yes, CoreyChem provides custom synthesis services for Oligomycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.