![2,3-Bis[(trimethylsilyl)oxy]propyl decanoate structure](/static/products/1116/1116-64-9.webp)
2,3-Bis[(trimethylsilyl)oxy]propyl decanoate
2,3-bis(trimethylsilyloxy)propyl decanoate
Also Known As: Monocaprin, 2TMS derivative|2,3-bis(trimethylsilyloxy)propyl decanoate|2,3-Bis[(trimethylsilyl)oxy]propyl decanoate|Decanoic acid 2,3-bis[(trimethylsilyl)oxy]propyl ester|2,3-bis-(OTMS)-.alpha.-glyceryl caprinate|Decanoic acid, 2,3-bis-(OTMS)-propyl ester|Decanoic acid, 2,3-bis(trimethylsiloxy)propyl ester|2,3-Bis[(trimethylsilyl)oxy]propyl decanoate #
| Molecular Formula | C19H42O4Si2 |
|---|---|
| Molecular Weight | 390.26218 g/mol |
| LogP | 5.7419 |
| Topological Polar Surface Area | 44.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Exact Mass | 390.26218 |
| Monoisotopic Mass | 390.26218 |
| Heavy Atoms | 25 |
| Complexity | 348.0 |
Chemical Identifiers
| CAS Number | 1116-64-9 |
|---|---|
| SMILES | CCCCCCCCCC(=O)OCC(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChIKey | XTRBTZGYEPNGOK-UHFFFAOYSA-N |
Product Overview
2,3-Bis[(trimethylsilyl)oxy]propyl decanoate (CAS 1116-64-9), with molecular formula C19H42O4Si2 and molecular weight 390.26218 g/mol. IUPAC: 2,3-bis(trimethylsilyloxy)propyl decanoate.
2,3-Bis[(trimethylsilyl)oxy]propyl decanoate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »