(+)-Manzamine B
TL;DR: (+)-Manzamine B (CAS 112663-92-0) is a chemical compound with molecular formula C36H46N4O and molecular weight 550.3672 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(8Z,21E)-27-(9H-pyrido[3,4-b]indol-1-yl)-25-oxa-3,16-diazapentacyclo[11.11.3.112,16.01,26.02,12]octacosa-8,21-diene
Also Known As: Manzamine B, (+)-Manzamine B
Technical Specifications
| Molecular Formula | C36H46N4O |
| Molecular Weight | 550.3672 g/mol |
| XLogP | 6.4 |
| Topological Polar Surface Area (TPSA) | 56.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 550.3672 Da |
| Heavy Atoms | 41 |
| Complexity | 983.0 |
| SMILES | C1CCNC2C3(CC/C=C\C1)CN4CCCC/C=C/CCC25C(O5)C(C3CC4)C6=NC=CC7=C6NC8=CC=CC=C78 |
| InChIKey | VLWWSOADVQPMJO-SOSXVSKCSA-N |
Chemical Property Profile of (+)-Manzamine B
Property Insights of (+)-Manzamine B
The XLogP value of 6.4 indicates that (+)-Manzamine B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 56.5 Ų, (+)-Manzamine B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, (+)-Manzamine B has 2 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of (+)-Manzamine B?
The CAS number of (+)-Manzamine B is 112663-92-0.
What is the molecular formula of (+)-Manzamine B?
The molecular formula of (+)-Manzamine B is C36H46N4O.
What is the molecular weight of (+)-Manzamine B?
The molecular weight of (+)-Manzamine B is 550.3672 g/mol.
Where can I buy (+)-Manzamine B?
You can request a quote for (+)-Manzamine B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for (+)-Manzamine B?
Yes, CoreyChem provides custom synthesis services for (+)-Manzamine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.