N-(1-Deoxyfructosyl)amphotericin B
TL;DR: N-(1-Deoxyfructosyl)amphotericin B (CAS 113693-19-9) is a chemical compound with molecular formula C53H83NO22 and molecular weight 1085.5406 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-3,5-dihydroxy-6-methyl-4-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]oxan-2-yl]oxy-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
Also Known As: N-Fru-amb, N-(1-Deoxyfructosyl)amphotericin B, N-(1-deoxy-D-fructos-lyl)amphotericin B, N-(1-Deoxy-D-fructos-l-yl)amphotericin B, Amphotericin B, N-(1-deoxy-beta-D-fructopyranos-l-yl)-
Technical Specifications
| Molecular Formula | C53H83NO22 |
| Molecular Weight | 1085.5406 g/mol |
| XLogP | -2.4 |
| Topological Polar Surface Area (TPSA) | 396.0 Ų |
| Hydrogen Bond Donors | 16 |
| Hydrogen Bond Acceptors | 23 |
| Rotatable Bonds | 6 |
| Exact Mass | 1085.5406 Da |
| Heavy Atoms | 76 |
| Complexity | 2000.0 |
| SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)NC[C@@]4([C@H]([C@@H]([C@@H](CO4)O)O)O)O)O |
| InChIKey | YAKICIHFDVEAMY-YAYRCEHOSA-N |
Chemical Property Profile of N-(1-Deoxyfructosyl)amphotericin B
Property Insights of N-(1-Deoxyfructosyl)amphotericin B
The XLogP value of -2.4 indicates that N-(1-Deoxyfructosyl)amphotericin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 396.0 Ų indicates high polarity, suggesting N-(1-Deoxyfructosyl)amphotericin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, N-(1-Deoxyfructosyl)amphotericin B has 16 hydrogen bond donor(s) and 23 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of N-(1-Deoxyfructosyl)amphotericin B?
The CAS number of N-(1-Deoxyfructosyl)amphotericin B is 113693-19-9.
What is the molecular formula of N-(1-Deoxyfructosyl)amphotericin B?
The molecular formula of N-(1-Deoxyfructosyl)amphotericin B is C53H83NO22.
What is the molecular weight of N-(1-Deoxyfructosyl)amphotericin B?
The molecular weight of N-(1-Deoxyfructosyl)amphotericin B is 1085.5406 g/mol.
Where can I buy N-(1-Deoxyfructosyl)amphotericin B?
You can request a quote for N-(1-Deoxyfructosyl)amphotericin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for N-(1-Deoxyfructosyl)amphotericin B?
Yes, CoreyChem provides custom synthesis services for N-(1-Deoxyfructosyl)amphotericin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.