neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-
TL;DR: neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- (CAS 114317-52-1) is a chemical compound with molecular formula C45H60N8O9S and molecular weight 888.4204 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(2S)-2-amino-4-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]-[(2S)-2-[[(2S)-4-methyl-2-[[2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]acetyl]amino]pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid
Also Known As: Neurokinin B (4-10), beta-asp(4)-Me-phe(7)-, Nkb (4-10), beta-asp(4)-Me-phe(7)-, 4-beta-Asp-7-Me-phe-neurokinin B (4-10), S-Propylthiosulfuric acid,2-amino-2-methyl, Neurokinin B (4-10), beta-aspartyl(4)-methylphenylalanine(7)-
Technical Specifications
| Molecular Formula | C45H60N8O9S |
| Molecular Weight | 888.4204 g/mol |
| XLogP | 0.4 |
| Topological Polar Surface Area (TPSA) | 298.0 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Exact Mass | 888.4204 Da |
| Heavy Atoms | 63 |
| Complexity | 1520.0 |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CCSC)C(=O)N(C(=O)C[C@@H](C(=O)O)N)C(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC2=CC=CC=C2)N)NC(=O)CNC(=O)[C@H](CC3=CC=CC=C3)NC |
| InChIKey | FBZNCWPOYDVAMN-DUGSHLAESA-N |
Chemical Property Profile of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-
Property Insights of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-
The XLogP value of 0.4 suggests moderate lipophilicity, balancing water solubility and membrane permeability for neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-. The TPSA of 298.0 Ų indicates high polarity, suggesting neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- has 8 hydrogen bond donor(s) and 13 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-?
The CAS number of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- is 114317-52-1.
What is the molecular formula of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-?
The molecular formula of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- is C45H60N8O9S.
What is the molecular weight of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-?
The molecular weight of neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- is 888.4204 g/mol.
Where can I buy neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-?
You can request a quote for neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)-?
Yes, CoreyChem provides custom synthesis services for neurokinin B (4-10), beta-Asp(4)-Me-Phe(7)- and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.