Asperketal B
TL;DR: Asperketal B (CAS 114763-51-8) is a chemical compound with molecular formula C20H30O2 and molecular weight 302.22458 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(2R,3R,3aR,6E,10E,11aR)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-furan]
Also Known As: Asperketal B, (2R,3R,3aR,6E,10E,11aR)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-furan], 3,7,11-Trimethyl-13-oxabicyclo(8.3.0)trideca-2,6-diene-12-spiro-2'-(5',5'-dimethyltetrahydrofuran), Spiro(cyclodeca(b)furan-2(3H),2'(5'H)-furan), 3a,4,5,8,9,11a-hexahydro-3,5',5',6,10-pentamethyl-, (2R*,3R*,3aR*,6E,10E,11aR*)-
Technical Specifications
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.22458 g/mol |
| XLogP | 3.8 |
| Topological Polar Surface Area (TPSA) | 18.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 302.22458 Da |
| Heavy Atoms | 22 |
| Complexity | 526.0 |
| SMILES | C[C@@H]1[C@H]2CC/C(=C/CC/C(=C/[C@@H]2O[C@@]13C=CC(O3)(C)C)/C)/C |
| InChIKey | SKBMVFLRYDINQT-ZTPOLTEHSA-N |
Chemical Property Profile of Asperketal B
Property Insights of Asperketal B
The XLogP value of 3.8 indicates that Asperketal B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 18.5 Ų, Asperketal B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Asperketal B has 0 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Asperketal B?
The CAS number of Asperketal B is 114763-51-8.
What is the molecular formula of Asperketal B?
The molecular formula of Asperketal B is C20H30O2.
What is the molecular weight of Asperketal B?
The molecular weight of Asperketal B is 302.22458 g/mol.
Where can I buy Asperketal B?
You can request a quote for Asperketal B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Asperketal B?
Yes, CoreyChem provides custom synthesis services for Asperketal B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.