(R)-Indenestrol B
TL;DR: (R)-Indenestrol B (CAS 115217-05-5) is a chemical compound with molecular formula C18H18O2 and molecular weight 266.13068 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(1R)-1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol
Also Known As: (R)-Indenestrol B, Indenoestrol B, (+)-indenestrol B, Indenestrol B, (+)-, (3R)-Indenestrol B
Technical Specifications
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.13068 g/mol |
| XLogP | 4.0 |
| Topological Polar Surface Area (TPSA) | 40.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 266.13068 Da |
| Heavy Atoms | 20 |
| Complexity | 379.0 |
| SMILES | CC[C@@H]1C2=C(C=C(C=C2)O)C(=C1C3=CC=C(C=C3)O)C |
| InChIKey | HJVFIQKBLPQQDY-OAHLLOKOSA-N |
Chemical Property Profile of (R)-Indenestrol B
Property Insights of (R)-Indenestrol B
The XLogP value of 4.0 indicates that (R)-Indenestrol B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 40.5 Ų, (R)-Indenestrol B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, (R)-Indenestrol B has 2 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of (R)-Indenestrol B?
The CAS number of (R)-Indenestrol B is 115217-05-5.
What is the molecular formula of (R)-Indenestrol B?
The molecular formula of (R)-Indenestrol B is C18H18O2.
What is the molecular weight of (R)-Indenestrol B?
The molecular weight of (R)-Indenestrol B is 266.13068 g/mol.
Where can I buy (R)-Indenestrol B?
You can request a quote for (R)-Indenestrol B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for (R)-Indenestrol B?
Yes, CoreyChem provides custom synthesis services for (R)-Indenestrol B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.