AC1LZY1N
(E)-N-[[4-(diaminomethylideneamino)sulfonylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide
Also Known As: BAS 00331761|SR-01000505927-1|(2E)-N-[({4-[(amidinoamino)sulfonyl]phenyl}amino)thioxomethyl]-3-(2-furyl)prop -2-enamide|(2E)-N-{[4-(carbamimidoylsulfamoyl)phenyl]carbamothioyl}-3-(furan-2-yl)prop-2-enamide|(E)-N-((4-(N-carbamimidoylsulfamoyl)phenyl)carbamothioyl)-3-(furan-2-yl)acrylamide|1-[4-(CARBAMIMIDAMIDOSULFONYL)PHENYL]-3-[(2E)-3-(FURAN-2-YL)PROP-2-ENOYL]THIOUREA|(E)-N-[[4-(diaminomethylideneamino)sulfonylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide
| Molecular Formula | C15H15N5O4S2 |
|---|---|
| Molecular Weight | 393.05655 g/mol |
| LogP | 0.7681 |
| Topological Polar Surface Area | 152.81 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 393.05655 |
| Monoisotopic Mass | 393.05655 |
| Heavy Atoms | 26 |
| Complexity | 944.4328 |
Chemical Identifiers
| CAS Number | 1164555-17-2 |
|---|---|
| SMILES | C1=COC(=C1)/C=C/C(=O)NC(=S)NC2=CC=C(C=C2)S(=O)(=O)N=C(N)N |
Product Overview
AC1LZY1N (CAS 1164555-17-2), with molecular formula C15H15N5O4S2 and molecular weight 393.05655 g/mol. IUPAC: (E)-N-[[4-(diaminomethylideneamino)sulfonylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
AC1LZY1N is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »