![(2E)-2-({[4-(4-methoxyphenoxy)phenyl]amino}methylidene)cyclopentanone structure](/static/products/116/1164561-84-5.png)
(2E)-2-({[4-(4-methoxyphenoxy)phenyl]amino}methylidene)cyclopentanone
(2E)-2-[[4-(4-methoxyphenoxy)anilino]methylidene]cyclopentan-1-one
Also Known As: (2E)-2-({[4-(4-methoxyphenoxy)phenyl]amino}methylidene)cyclopentanone|(2E)-2-[[4-(4-methoxyphenoxy)anilino]methylidene]cyclopentan-1-one|(E)-2-(((4-(4-methoxyphenoxy)phenyl)amino)methylene)cyclopentanone|2-[1-[4-(4-Methoxy-phenoxy)-phenylamino]-meth-(E)-ylidene]-cyclopentanone
| Molecular Formula | C19H19NO3 |
|---|---|
| Molecular Weight | 309.1365 g/mol |
| LogP | 4.5363 |
| Topological Polar Surface Area | 47.56 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 309.1365 |
| Monoisotopic Mass | 309.1365 |
| Heavy Atoms | 23 |
| Complexity | 702.39954 |
Chemical Identifiers
| CAS Number | 1164561-84-5 |
|---|---|
| SMILES | COC1=CC=C(C=C1)OC2=CC=C(C=C2)N/C=C/3\CCCC3=O |
Product Overview
(2E)-2-({[4-(4-methoxyphenoxy)phenyl]amino}methylidene)cyclopentanone (CAS 1164561-84-5), with molecular formula C19H19NO3 and molecular weight 309.1365 g/mol. IUPAC: (2E)-2-[[4-(4-methoxyphenoxy)anilino]methylidene]cyclopentan-1-one.
(2E)-2-({[4-(4-methoxyphenoxy)phenyl]amino}methylidene)cyclopentanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »