4-Cyano-1-Dimethyl(tert-butyl)silyloxybenzene
4-[tert-butyl(dimethyl)silyl]oxybenzonitrile
Also Known As: 4-Cyanophenol, TBDMS derivative|4-[(tert-butyldimethylsilyl)oxy]benzonitrile|4-Cyano-1-Dimethyl(tert-butyl)silyloxybenzene|4-(tert-Butyldimethylsiloxy)benzonitrile|p-(tert-Butyldimethylsilyloxy)benzonitrile|4-[tert-butyl(dimethyl)silyl]oxybenzonitrile|4-Cyanophenyl(tert-butyldimethylsilyl) ether|4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzonitrile
| Molecular Formula | C13H19NOSi |
|---|---|
| Molecular Weight | 233.1236 g/mol |
| LogP | 3.94228 |
| Topological Polar Surface Area | 33.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 233.1236 |
| Monoisotopic Mass | 233.1236 |
| Heavy Atoms | 16 |
| Complexity | 276.0 |
Chemical Identifiers
| CAS Number | 117635-43-5 |
|---|---|
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C#N |
| InChIKey | FFJFJEYUUBQRSB-UHFFFAOYSA-N |
Product Overview
4-Cyano-1-Dimethyl(tert-butyl)silyloxybenzene (CAS 117635-43-5), with molecular formula C13H19NOSi and molecular weight 233.1236 g/mol. IUPAC: 4-[tert-butyl(dimethyl)silyl]oxybenzonitrile.
4-Cyano-1-Dimethyl(tert-butyl)silyloxybenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »