Bistratamide B
TL;DR: Bistratamide B (CAS 120881-21-2) is a chemical compound with molecular formula C27H32N6O4S2 and molecular weight 568.1926 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
18-benzyl-7,11-dimethyl-4-propan-2-yl-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),12(23),19(22)-tetraene-2,9,16-trione
Also Known As: Bistratamide B, 18-benzyl-7,11-dimethyl-4-propan-2-yl-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),12(23),19(22)-tetraene-2,9,16-trione, 6-Oxa-13,20-dithia-3,10,17,22,23,24-hexaazatetracyclo(17.2.1.15,8.112,15)tetracosa-1(21),5(24),12(23),19(22)-tetraene-2,9,16-trione, 7,11-dimethyl-4-(1-methylethyl)-18-(phenylmethyl)-
Technical Specifications
| Molecular Formula | C27H32N6O4S2 |
| Molecular Weight | 568.1926 g/mol |
| XLogP | 3.2 |
| Topological Polar Surface Area (TPSA) | 188.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Exact Mass | 568.1926 Da |
| Heavy Atoms | 39 |
| Complexity | 1020.0 |
| SMILES | CC1C2C(=O)NC(C3=NC(CS3)C(=O)NC(C4=NC(=CS4)C(=O)NC(C(=N2)O1)C(C)C)CC5=CC=CC=C5)C |
| InChIKey | BRLJUCBNCZSZRH-UHFFFAOYSA-N |
Chemical Property Profile of Bistratamide B
Property Insights of Bistratamide B
The XLogP value of 3.2 indicates that Bistratamide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 188.0 Ų indicates high polarity, suggesting Bistratamide B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Bistratamide B has 3 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Bistratamide B?
The CAS number of Bistratamide B is 120881-21-2.
What is the molecular formula of Bistratamide B?
The molecular formula of Bistratamide B is C27H32N6O4S2.
What is the molecular weight of Bistratamide B?
The molecular weight of Bistratamide B is 568.1926 g/mol.
Where can I buy Bistratamide B?
You can request a quote for Bistratamide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Bistratamide B?
Yes, CoreyChem provides custom synthesis services for Bistratamide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.