9-Bromo-10-phenyl-anthracene
9-bromo-10-phenylanthracene
Also Known As: 9-bromo-10-phenylanthracene|Anthracene, 9-bromo-10-phenyl-|9-bromo-10-phenyl-anthracene|10-bromo-9-phenylanthracene|9-bromo10-phenylanthracene|9-Phenyl-10-bromanthracen|9-phenyl-10-bromoanthracene|10-bromo-9-phenyl-anthracene|9-bromo-10-phenyl anthracene|bromo-9 phenyl-10 anthracene|9-bromo-10-(phenyl)anthracene|AMY8613|ANTHRACENE, 9-BROMO-10-PHENYL|KS-00000EU4|9-Bromo-10-phenylanthracene =98%|CB-3161|CS-W011944|DS-3834|4CH-024090
| Molecular Formula | C20H13Br |
|---|---|
| Molecular Weight | 332.02005 g/mol |
| LogP | 6.4225 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 1 |
| Exact Mass | 332.02005 |
| Monoisotopic Mass | 332.02005 |
| Heavy Atoms | 21 |
| Complexity | 882.6462 |
Chemical Identifiers
| CAS Number | 121848-75-7 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)Br |
Product Overview
9-Bromo-10-phenyl-anthracene (CAS 121848-75-7), with molecular formula C20H13Br and molecular weight 332.02005 g/mol. IUPAC: 9-bromo-10-phenylanthracene.
9-Bromo-10-phenyl-anthracene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »