16-Epinormacusine B
TL;DR: 16-Epinormacusine B (CAS 126640-98-0) is a chemical compound with molecular formula C19H22N2O and molecular weight 294.17322 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(15-ethylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-yl)methanol
Also Known As: Tombozine, 16-Epinormacusine B, 16-Epikoumidine, 10-Deoxysarpagine, (19Z)-Normacusine B
Technical Specifications
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.17322 g/mol |
| XLogP | 2.1 |
| Topological Polar Surface Area (TPSA) | 39.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 294.17322 Da |
| Heavy Atoms | 22 |
| Complexity | 490.0 |
| SMILES | CC=C1CN2C3CC1C(C2CC4=C3NC5=CC=CC=C45)CO |
| InChIKey | VXTDUGOBAOLMED-UHFFFAOYSA-N |
Chemical Property Profile of 16-Epinormacusine B
Property Insights of 16-Epinormacusine B
The XLogP value of 2.1 suggests moderate lipophilicity, balancing water solubility and membrane permeability for 16-Epinormacusine B. With a topological polar surface area (TPSA) of 39.3 Ų, 16-Epinormacusine B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, 16-Epinormacusine B has 2 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of 16-Epinormacusine B?
The CAS number of 16-Epinormacusine B is 126640-98-0.
What is the molecular formula of 16-Epinormacusine B?
The molecular formula of 16-Epinormacusine B is C19H22N2O.
What is the molecular weight of 16-Epinormacusine B?
The molecular weight of 16-Epinormacusine B is 294.17322 g/mol.
Where can I buy 16-Epinormacusine B?
You can request a quote for 16-Epinormacusine B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for 16-Epinormacusine B?
Yes, CoreyChem provides custom synthesis services for 16-Epinormacusine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.