4-Chloro-1-dimethyl(tert-butyl)silyloxybenzene
tert-butyl-(4-chlorophenoxy)-dimethylsilane
Also Known As: ACMC-20ms3l|Pyridinium,1-ethyl-3-phenyl|TERT-BUTYL(4-CHLOROPHENOXY)DIMETHYLSILANE|4-Chloro-1-dimethyl(tert-butyl)silyloxybenzene|4-Chlorophenol, TBDMS derivative|tert-butyl-(4-chlorophenoxy)-dimethylsilane|tert-Butyldimethyl(4-chlorophenoxy)silane|tert-Butyl(4-chlorophenoxy)di(methyl)silane|1-((tert-butyldimethylsilyl)oxy)-4-chlorobenzene|4-Chlorophenol, tert-butyldimethylsilyl ether|1-(tert-Butyldimethylsilyloxy)-4-chlorobenzene|1-Chloro-4-(tert-butyldimethylsilyloxy)benzene|1-[(tert-Butyldimethylsilyl)oxy]-4-chlorobenzene|Silane, (4-chlorophenoxy)(1,1-dimethylethyl)dimethyl-
| Molecular Formula | C12H19ClOSi |
|---|---|
| Molecular Weight | 242.08937 g/mol |
| LogP | 4.724 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 242.08937 |
| Monoisotopic Mass | 242.08937 |
| Heavy Atoms | 15 |
| Complexity | 202.0 |
Chemical Identifiers
| CAS Number | 126644-72-2 |
|---|---|
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)Cl |
| InChIKey | GIJYKQZUGLZCKZ-UHFFFAOYSA-N |
Product Overview
4-Chloro-1-dimethyl(tert-butyl)silyloxybenzene (CAS 126644-72-2), with molecular formula C12H19ClOSi and molecular weight 242.08937 g/mol. IUPAC: tert-butyl-(4-chlorophenoxy)-dimethylsilane.
4-Chloro-1-dimethyl(tert-butyl)silyloxybenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »