Fasciculic acid B
TL;DR: Fasciculic acid B (CAS 126882-55-1) is a chemical compound with molecular formula C36H60O9 and molecular weight 636.4237 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
5-[[(2R,3R,10S,12S,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-3,12-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-5-oxopentanoic acid
Also Known As: Fasciculic acid B, 2-O-(3-Hydroxy-3-methylglutaryl) fasciculol B, 5-[[(2R,3R,10S,12S,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-3,12-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-5-oxopentanoic acid, Lanost-8-ene-2,3,12,24,25-pentol, 2-(hydrogen 3-hydroxy-3-methylpentanedioate), (2alpha,3beta,12alpha,24R)-
Technical Specifications
| Molecular Formula | C36H60O9 |
| Molecular Weight | 636.4237 g/mol |
| XLogP | 3.9 |
| Topological Polar Surface Area (TPSA) | 165.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Exact Mass | 636.4237 Da |
| Heavy Atoms | 45 |
| Complexity | 1190.0 |
| SMILES | C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1CC[C@@]2([C@@]1([C@H](CC3=C2CCC4[C@@]3(C[C@H]([C@@H](C4(C)C)O)OC(=O)CC(C)(CC(=O)O)O)C)O)C)C |
| InChIKey | SWRXIGFQDQTNKP-RAOJVCEKSA-N |
Chemical Property Profile of Fasciculic acid B
Property Insights of Fasciculic acid B
The XLogP value of 3.9 indicates that Fasciculic acid B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 165.0 Ų indicates high polarity, suggesting Fasciculic acid B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Fasciculic acid B has 6 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Fasciculic acid B?
The CAS number of Fasciculic acid B is 126882-55-1.
What is the molecular formula of Fasciculic acid B?
The molecular formula of Fasciculic acid B is C36H60O9.
What is the molecular weight of Fasciculic acid B?
The molecular weight of Fasciculic acid B is 636.4237 g/mol.
Where can I buy Fasciculic acid B?
You can request a quote for Fasciculic acid B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Fasciculic acid B?
Yes, CoreyChem provides custom synthesis services for Fasciculic acid B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.