Sennoside B
(9S)-9-[(9R)-2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid
Also Known As: Sennoside B|Sennoside A|SennosideB|Sennoside-B|Tisasen B|Sennoside B RS|Sennoside B CRS|Sennoside B (Standard)|SENNOSIDE B [USP-RS]|SENNOSIDE B [WHO-DD]|EINECS 204-895-0|SENNOSIDE B (SENNA)|SENNOSIDE B (USP-RS)|HY-N0366R|Sennoside B (6CI,7CI,8CI)|3-(Methoxymethyl)cyclohexan-1-one|EX-A4953|SENNOSIDES SENNOSIDE B [MI]|NP0907|s4018|SENNOSIDE B (REFERENCE GRADE)
| Molecular Formula | C42H38O20 |
|---|---|
| Molecular Weight | 862.1956 g/mol |
| LogP | -1.1 |
| Topological Polar Surface Area | 347.96 Ų |
| Hydrogen Bond Donors | 12 |
| Hydrogen Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Exact Mass | 862.1956 |
| Heavy Atoms | 62 |
| Complexity | 2327.1 |
Chemical Identifiers
| CAS Number | 128-57-4 |
|---|---|
| SMILES | C1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C([C@@H]2[C@H]5C6=C(C(=CC=C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O |
Product Overview
Sennoside B (CAS 128-57-4), with molecular formula C42H38O20 and molecular weight 862.1956 g/mol. IUPAC: (9S)-9-[(9R)-2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid.
Frequently Asked Questions
📚 Academic Support
Scientific research papers and technical documentation supporting this product for informed procurement decisions.
Technical Blog Article
Multi-source research profile: chemical properties, regulatory status, and sourcing guide for Sennoside B.
Browse Technical Blog →No research papers found for this product yet.
We continuously update our academic references. Check back soon!