Dexylosylbenanomicin B
TL;DR: Dexylosylbenanomicin B (CAS 128110-33-8) is a chemical compound with molecular formula C34H34N2O14 and molecular weight 694.201 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(2R)-2-[[(5S,6S)-5-[(2S,3R,4S,5R,6R)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]oxy-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl]amino]propanoic acid
Also Known As: Dexylosylbenanomicin B, Desxylosyl-benanomicin B, Dexylosylpradimicin C, 3A-De-O-xylosylbenanomycin B, KST-1A1039
Technical Specifications
| Molecular Formula | C34H34N2O14 |
| Molecular Weight | 694.201 g/mol |
| XLogP | -0.9 |
| Topological Polar Surface Area (TPSA) | 276.0 Ų |
| Hydrogen Bond Donors | 9 |
| Hydrogen Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Exact Mass | 694.201 Da |
| Heavy Atoms | 50 |
| Complexity | 1330.0 |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](C3=CC4=C(C(=C3C5=C2C=C(C(=C5O)C(=O)N[C@H](C)C(=O)O)C)O)C(=O)C6=C(C4=O)C(=CC(=C6)OC)O)O)O)O)N |
| InChIKey | RLAZQZRIYCOWMY-JAULALIESA-N |
Chemical Property Profile of Dexylosylbenanomicin B
Property Insights of Dexylosylbenanomicin B
The XLogP value of -0.9 indicates that Dexylosylbenanomicin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 276.0 Ų indicates high polarity, suggesting Dexylosylbenanomicin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Dexylosylbenanomicin B has 9 hydrogen bond donor(s) and 15 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Dexylosylbenanomicin B?
The CAS number of Dexylosylbenanomicin B is 128110-33-8.
What is the molecular formula of Dexylosylbenanomicin B?
The molecular formula of Dexylosylbenanomicin B is C34H34N2O14.
What is the molecular weight of Dexylosylbenanomicin B?
The molecular weight of Dexylosylbenanomicin B is 694.201 g/mol.
Where can I buy Dexylosylbenanomicin B?
You can request a quote for Dexylosylbenanomicin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Dexylosylbenanomicin B?
Yes, CoreyChem provides custom synthesis services for Dexylosylbenanomicin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.