Strobilurin B
TL;DR: Strobilurin B (CAS 128862-28-2) is a chemical compound with molecular formula C17H19ClO4 and molecular weight 322.0972 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate
Also Known As: Strobilurin B, methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate, Methyl (2E,3E,5E)a6a(4achloroa3amethoxyphenyl)a2a (methoxymethylidene)a3amethylhexaa3,5adienoate
Technical Specifications
| Molecular Formula | C17H19ClO4 |
| Molecular Weight | 322.0972 g/mol |
| XLogP | 4.5 |
| Topological Polar Surface Area (TPSA) | 44.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 322.0972 Da |
| Heavy Atoms | 22 |
| Complexity | 454.0 |
| SMILES | C/C(=C\C=C\C1=CC(=C(C=C1)Cl)OC)/C(=C\OC)/C(=O)OC |
| InChIKey | ZDIQYKMDNQULMX-DVXCKLMHSA-N |
Chemical Property Profile of Strobilurin B
Property Insights of Strobilurin B
The XLogP value of 4.5 indicates that Strobilurin B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 44.8 Ų, Strobilurin B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Strobilurin B has 0 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Strobilurin B?
The CAS number of Strobilurin B is 128862-28-2.
What is the molecular formula of Strobilurin B?
The molecular formula of Strobilurin B is C17H19ClO4.
What is the molecular weight of Strobilurin B?
The molecular weight of Strobilurin B is 322.0972 g/mol.
Where can I buy Strobilurin B?
You can request a quote for Strobilurin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Strobilurin B?
Yes, CoreyChem provides custom synthesis services for Strobilurin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.