Diazonamide B
TL;DR: Diazonamide B (CAS 131703-15-6) is a chemical compound with molecular formula C35H25BrCl2N6O4 and molecular weight 742.04974 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(10S,13S,21S)-13-amino-17-bromo-3,35-dichloro-10-propan-2-yl-8,37,40-trioxa-4,11,22,34,39-pentazadecacyclo[27.6.1.12,5.16,9.115,19.118,21.07,20.020,24.023,28.033,36]tetraconta-1(35),2,4,6,9(39),15(38),16,18,23(28),24,26,29(36),30,32-tetradecaen-12-one
Also Known As: Diazonamide B
Technical Specifications
| Molecular Formula | C35H25BrCl2N6O4 |
| Molecular Weight | 742.04974 g/mol |
| XLogP | 7.3 |
| Topological Polar Surface Area (TPSA) | 144.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Exact Mass | 742.04974 Da |
| Heavy Atoms | 48 |
| Complexity | 1310.0 |
| SMILES | CC(C)[C@H]1C2=NC3=C(O2)C45[C@@H](NC6=C(C=CC=C64)C7=C8C(=CC=C7)NC(=C8C9=C(N=C3O9)Cl)Cl)OC2=C5C=C(C[C@@H](C(=O)N1)N)C=C2Br |
| InChIKey | FKXXVTVUWZIJHW-DLJKJMPDSA-N |
Chemical Property Profile of Diazonamide B
Property Insights of Diazonamide B
The XLogP value of 7.3 indicates that Diazonamide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 144.0 Ų indicates high polarity, suggesting Diazonamide B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Diazonamide B has 4 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Diazonamide B?
The CAS number of Diazonamide B is 131703-15-6.
What is the molecular formula of Diazonamide B?
The molecular formula of Diazonamide B is C35H25BrCl2N6O4.
What is the molecular weight of Diazonamide B?
The molecular weight of Diazonamide B is 742.04974 g/mol.
Where can I buy Diazonamide B?
You can request a quote for Diazonamide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Diazonamide B?
Yes, CoreyChem provides custom synthesis services for Diazonamide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.