Diethyl 2,4-diacetyl-3-phenylpentanedioate
diethyl 2,4-diacetyl-3-phenylpentanedioate
Also Known As: diethyl 2,4-diacetyl-3-phenylpentanedioate|NCGC00343063-01|2,4-Diacetyl-3-phenyl-glutarsaeurediethylester|AB01334952-02|diethyl 2,4-diacetyl-3-phenylpentane-1,5-dioate|DIETHYL2,4-DIACETYL-3-PHENYLPENTANEDIOATE|2,4-Diacetyl-3-phenyl-pentanedioic acid diethyl ester|A3007/0126678|Pentanedioic acid, 2,4-diacetyl-3-phenyl-, diethyl ester|Pentanedioic acid,2,4-diacetyl-3-phenyl-, 1,5-diethyl ester
| Molecular Formula | C19H24O6 |
|---|---|
| Molecular Weight | 348.1573 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 86.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Exact Mass | 348.1573 |
| Monoisotopic Mass | 348.1573 |
| Heavy Atoms | 25 |
| Complexity | 456.0 |
Chemical Identifiers
| CAS Number | 13277-74-2 |
|---|---|
| SMILES | CCOC(=O)C(C(C1=CC=CC=C1)C(C(=O)C)C(=O)OCC)C(=O)C |
| InChIKey | VJDMHFPDRYFKOU-UHFFFAOYSA-N |
Product Overview
Diethyl 2,4-diacetyl-3-phenylpentanedioate (CAS 13277-74-2), with molecular formula C19H24O6 and molecular weight 348.1573 g/mol. IUPAC: diethyl 2,4-diacetyl-3-phenylpentanedioate.
Diethyl 2,4-diacetyl-3-phenylpentanedioate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »