Swinholide B
TL;DR: Swinholide B (CAS 132943-68-1) is a chemical compound with molecular formula C77H130O20 and molecular weight 1374.9155 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(5E,7Z,27E,29Z)-3,13,15,25,35,37-hexahydroxy-11,33-bis[3-hydroxy-6-(4-methoxy-6-methyloxan-2-yl)-4-methylhexan-2-yl]-17,39-dimethoxy-6,12,16,28,34-pentamethyl-10,32,45,46-tetraoxatricyclo[39.3.1.119,23]hexatetraconta-5,7,21,27,29,43-hexaene-9,31-dione
Also Known As: Swinholide B, 16-Demethylswinholide A, Swinholide A, 16-demethyl-, (5E,7Z,27E,29Z)-3,13,15,25,35,37-hexahydroxy-11,33-bis[3-hydroxy-6-(4-methoxy-6-methyloxan-2-yl)-4-methylhexan-2-yl]-17,39-dimethoxy-6,12,16,28,34-pentamethyl-10,32,45,46-tetraoxatricyclo[39.3.1.119,23]hexatetraconta-5,7,21,27,29,43-hexaene-9,31-dione
Technical Specifications
| Molecular Formula | C77H130O20 |
| Molecular Weight | 1374.9155 g/mol |
| XLogP | 10.1 |
| Topological Polar Surface Area (TPSA) | 288.0 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Exact Mass | 1374.9155 Da |
| Heavy Atoms | 97 |
| Complexity | 2450.0 |
| SMILES | CC1CC(CC(O1)CCC(C)C(C(C)C2C(C(CC(CC(CC3CC=CC(O3)CC(C/C=C(/C=C\C(=O)OC(C(C(CC(C(C(CC4CC=CC(O4)CC(C/C=C(/C=C\C(=O)O2)\C)O)OC)C)O)O)C)C(C)C(C(C)CCC5CC(CC(O5)C)OC)O)\C)O)OC)O)O)C)O)OC |
| InChIKey | UBEMSBNKOSVIQI-LPJTZETHSA-N |
Chemical Property Profile of Swinholide B
Property Insights of Swinholide B
The XLogP value of 10.1 indicates that Swinholide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 288.0 Ų indicates high polarity, suggesting Swinholide B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Swinholide B has 8 hydrogen bond donor(s) and 20 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Swinholide B?
The CAS number of Swinholide B is 132943-68-1.
What is the molecular formula of Swinholide B?
The molecular formula of Swinholide B is C77H130O20.
What is the molecular weight of Swinholide B?
The molecular weight of Swinholide B is 1374.9155 g/mol.
Where can I buy Swinholide B?
You can request a quote for Swinholide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Swinholide B?
Yes, CoreyChem provides custom synthesis services for Swinholide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.