1-Phenylselenenylmenthene
[(5S)-5-methyl-2-propan-2-ylcyclohexen-1-yl]selanylbenzene
Also Known As: 1-phenylselenenylmenthene|phenylselenenylmenth-1-(2)-ene|(2-isopropyl-5-methyl-cyclohex-1-enylselanyl)-benzene|[(2-isopropyl-5-methylcyclohex-1-en-1-yl)seleno]benzene|((2-isopropyl-5-methylcyclohex-1-en-1-yl)seleno)benzene|[(5S)-5-methyl-2-propan-2-ylcyclohexen-1-yl]selanylbenzene|benzene, [[(5S)-5-methyl-2-(1-methylethyl)-1-cyclohexen-1-yl]seleno]-|{[(5S)-5-Methyl-2-(propan-2-yl)cyclohex-1-en-1-yl]selanyl}benzene|benzene, (((5S)-5-methyl-2-(1-methylethyl)-1-cyclohexen-1-yl)seleno)-
| Molecular Formula | C16H22Se |
|---|---|
| Molecular Weight | 294.08868 g/mol |
| LogP | 3.7462 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 294.08868 |
| Monoisotopic Mass | 294.08868 |
| Heavy Atoms | 17 |
| Complexity | 271.0 |
Chemical Identifiers
| CAS Number | 134076-53-2 |
|---|---|
| SMILES | C[C@H]1CCC(=C(C1)[Se]C2=CC=CC=C2)C(C)C |
| InChIKey | FOLNFOIMKSCWDC-ZDUSSCGKSA-N |
Product Overview
1-Phenylselenenylmenthene (CAS 134076-53-2), with molecular formula C16H22Se and molecular weight 294.08868 g/mol. IUPAC: [(5S)-5-methyl-2-propan-2-ylcyclohexen-1-yl]selanylbenzene.
1-Phenylselenenylmenthene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »