2-[(3-{[(3-Aminophenyl)carbonyl]amino}phenyl)sulfonyl]ethyl hydrogen sulfate
2-[3-[(3-aminobenzoyl)amino]phenyl]sulfonylethyl hydrogen sulfate
Also Known As: SR-01000201278-1|1-[(3-aminobenzoyl)amino]-3-(2-sulfooxyethylsulfonyl)benzene|2-((3-(3-aminobenzamido)phenyl)sulfonyl)ethyl hydrogen sulfate|2-[3-(3-AMINOBENZAMIDO)BENZENESULFONYL]ETHOXYSULFONIC ACID|2-[3-[(3-aminobenzoyl)amino]phenyl]sulfonylethyl hydrogen sulfate|2-[(3-{[(3-aminophenyl)carbonyl]amino}phenyl)sulfonyl]ethyl hydrogen sulfate
| Molecular Formula | C15H16N2O7S2 |
|---|---|
| Molecular Weight | 400.0399 g/mol |
| LogP | 1.1142 |
| Topological Polar Surface Area | 152.86 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Exact Mass | 400.0399 |
| Monoisotopic Mass | 400.0399 |
| Heavy Atoms | 26 |
| Complexity | 1017.79535 |
Chemical Identifiers
| CAS Number | 134449-72-2 |
|---|---|
| SMILES | C1=CC(=CC(=C1)N)C(=O)NC2=CC(=CC=C2)S(=O)(=O)CCOS(=O)(=O)O |
Product Overview
2-[(3-{[(3-Aminophenyl)carbonyl]amino}phenyl)sulfonyl]ethyl hydrogen sulfate (CAS 134449-72-2), with molecular formula C15H16N2O7S2 and molecular weight 400.0399 g/mol. IUPAC: 2-[3-[(3-aminobenzoyl)amino]phenyl]sulfonylethyl hydrogen sulfate.
2-[(3-{[(3-Aminophenyl)carbonyl]amino}phenyl)sulfonyl]ethyl hydrogen sulfate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »