Weinbersterol disulfate B
TL;DR: Weinbersterol disulfate B (CAS 134515-54-1) is a chemical compound with molecular formula C30H52O10S2 and molecular weight 636.3002 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
[(2S,3S,5S,10S,13R,16S,17R)-16-hydroxy-13-(hydroxymethyl)-10-methyl-17-[4-(2-methyl-1-propan-2-ylcyclopropyl)butan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate
Also Known As: Weinbersterol disulfate B, Sterol HB100 (Disodium salt), Sterol HB100 (*Disodium salt*), 24-Norcholane-2,3,16,18-tetrol, 23-(2-methyl-1-(1-methylethyl)cyclopropyl)-, 2,3-bis(hydrogen sulfate), (2beta,3alpha,5alpha,16beta,20xi)-, [(2S,3S,5S,10S,13R,16S,17R)-16-hydroxy-13-(hydroxymethyl)-10-methyl-17-[4-(2-methyl-1-propan-2-ylcyclopropyl)butan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate
Technical Specifications
| Molecular Formula | C30H52O10S2 |
| Molecular Weight | 636.3002 g/mol |
| XLogP | 5.6 |
| Topological Polar Surface Area (TPSA) | 184.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Exact Mass | 636.3002 Da |
| Heavy Atoms | 42 |
| Complexity | 1210.0 |
| SMILES | CC1CC1(CCC(C)[C@H]2[C@H](CC3[C@@]2(CCC4C3CC[C@@H]5[C@@]4(C[C@@H]([C@H](C5)OS(=O)(=O)O)OS(=O)(=O)O)C)CO)O)C(C)C |
| InChIKey | USJRJXMGUMEVEB-INEALCQFSA-N |
Chemical Property Profile of Weinbersterol disulfate B
Property Insights of Weinbersterol disulfate B
The XLogP value of 5.6 indicates that Weinbersterol disulfate B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 184.0 Ų indicates high polarity, suggesting Weinbersterol disulfate B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Weinbersterol disulfate B has 4 hydrogen bond donor(s) and 10 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Weinbersterol disulfate B?
The CAS number of Weinbersterol disulfate B is 134515-54-1.
What is the molecular formula of Weinbersterol disulfate B?
The molecular formula of Weinbersterol disulfate B is C30H52O10S2.
What is the molecular weight of Weinbersterol disulfate B?
The molecular weight of Weinbersterol disulfate B is 636.3002 g/mol.
Where can I buy Weinbersterol disulfate B?
You can request a quote for Weinbersterol disulfate B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Weinbersterol disulfate B?
Yes, CoreyChem provides custom synthesis services for Weinbersterol disulfate B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.