B 1194
TL;DR: B 1194 (CAS 136996-64-0) is a chemical compound with molecular formula C17H22Cl2F3N3OS and molecular weight 443.08127 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
4-methyl-5-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-1,3-thiazole;dihydrochloride
Also Known As: B 1194, Piperazine, 1-(2-((4-methyl-5-thiazolyl)oxy)ethyl)-4-(3-(trifluoromethyl)phenyl)-, dihydrochloride, 4-Methyl-5-(2-(4-m-trifluoromethylphenylpiperazin-1-yl)ethoxy)thiazole dihydrochloride, 1-{2-[(4-Methyl-1,3-thiazol-5-yl)oxy]ethyl}-4-[3-(trifluoromethyl)phenyl]piperazine--hydrogen chloride (1/2), 4-methyl-5-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-1,3-thiazole dihydrochloride
Technical Specifications
| Molecular Formula | C17H22Cl2F3N3OS |
| Molecular Weight | 443.08127 g/mol |
| XLogP | 4.51492 |
| Topological Polar Surface Area (TPSA) | 56.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Exact Mass | 443.08127 Da |
| Heavy Atoms | 27 |
| Complexity | 418.0 |
| SMILES | CC1=C(SC=N1)OCCN2CCN(CC2)C3=CC=CC(=C3)C(F)(F)F.Cl.Cl |
| InChIKey | OHNYZXJXEITQBS-UHFFFAOYSA-N |
Chemical Property Profile of B 1194
Property Insights of B 1194
The XLogP value of 4.51492 indicates that B 1194 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 56.8 Ų, B 1194 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 1194 has 2 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of B 1194?
The CAS number of B 1194 is 136996-64-0.
What is the molecular formula of B 1194?
The molecular formula of B 1194 is C17H22Cl2F3N3OS.
What is the molecular weight of B 1194?
The molecular weight of B 1194 is 443.08127 g/mol.
Where can I buy B 1194?
You can request a quote for B 1194 directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for B 1194?
Yes, CoreyChem provides custom synthesis services for B 1194 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.