B 1429
TL;DR: B 1429 (CAS 136996-78-6) is a chemical compound with molecular formula C20H30ClN3O3S and molecular weight 427.16965 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
1-[(4-methyl-1,3-thiazol-5-yl)oxy]-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride
Also Known As: B 1429, 3-(4-o-Isopropoxyphenylpiperazin-1-yl)-1-(4-methylthiazolyl-5-oxy)propan-2-ol hydrochloride, 1-Piperazineethanol, 4-(2-(1-methylethoxy)phenyl)-alpha-(((4-methyl-5-thiazolyl)oxy)methyl)-,monohydrochloride, 1-[(4-Methyl-1,3-thiazol-5-yl)oxy]-3-(4-{2-[(propan-2-yl)oxy]phenyl}piperazin-1-yl)propan-2-ol--hydrogen chloride (1/1), 1-[(4-methyl-1,3-thiazol-5-yl)oxy]-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-ol hydrochloride
Technical Specifications
| Molecular Formula | C20H30ClN3O3S |
| Molecular Weight | 427.16965 g/mol |
| XLogP | 3.22242 |
| Topological Polar Surface Area (TPSA) | 86.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Exact Mass | 427.16965 Da |
| Heavy Atoms | 28 |
| Complexity | 435.0 |
| SMILES | CC1=C(SC=N1)OCC(CN2CCN(CC2)C3=CC=CC=C3OC(C)C)O.Cl |
| InChIKey | PQFIQIOUNCXCEF-UHFFFAOYSA-N |
Chemical Property Profile of B 1429
Property Insights of B 1429
The XLogP value of 3.22242 indicates that B 1429 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 86.3 Ų falls within the moderate polarity range, balancing permeability and solubility for B 1429. Following Lipinski's Rule of Five, B 1429 has 2 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of B 1429?
The CAS number of B 1429 is 136996-78-6.
What is the molecular formula of B 1429?
The molecular formula of B 1429 is C20H30ClN3O3S.
What is the molecular weight of B 1429?
The molecular weight of B 1429 is 427.16965 g/mol.
Where can I buy B 1429?
You can request a quote for B 1429 directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for B 1429?
Yes, CoreyChem provides custom synthesis services for B 1429 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.