B 1510
TL;DR: B 1510 (CAS 136996-81-1) is a chemical compound with molecular formula C18H26ClN3O3S and molecular weight 399.13834 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(4-methyl-1,3-thiazol-5-yl)oxy]propan-2-ol;hydrochloride
Also Known As: B 1510, 1-Piperazineethanol, 4-(2-methoxyphenyl)-alpha-(((4-methyl-5-thiazolyl)oxy)methyl)-, monohydrochloride, 3-(4-o-Methoxyphenylpiperazin-1-yl)-1-(4-methylthiazolyl-5-oxy)propan-2-ol hydrochloride, 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(4-methyl-1,3-thiazol-5-yl)oxy]propan-2-ol hydrochloride, 1-[4-(2-Methoxyphenyl)piperazin-1-yl]-3-[(4-methyl-1,3-thiazol-5-yl)oxy]propan-2-ol--hydrogen chloride (1/1)
Technical Specifications
| Molecular Formula | C18H26ClN3O3S |
| Molecular Weight | 399.13834 g/mol |
| XLogP | 2.44382 |
| Topological Polar Surface Area (TPSA) | 86.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Exact Mass | 399.13834 Da |
| Heavy Atoms | 26 |
| Complexity | 396.0 |
| SMILES | CC1=C(SC=N1)OCC(CN2CCN(CC2)C3=CC=CC=C3OC)O.Cl |
| InChIKey | GJDQAZWMYGMPTD-UHFFFAOYSA-N |
Chemical Property Profile of B 1510
Property Insights of B 1510
The XLogP value of 2.44382 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 1510. The TPSA of 86.3 Ų falls within the moderate polarity range, balancing permeability and solubility for B 1510. Following Lipinski's Rule of Five, B 1510 has 2 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of B 1510?
The CAS number of B 1510 is 136996-81-1.
What is the molecular formula of B 1510?
The molecular formula of B 1510 is C18H26ClN3O3S.
What is the molecular weight of B 1510?
The molecular weight of B 1510 is 399.13834 g/mol.
Where can I buy B 1510?
You can request a quote for B 1510 directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for B 1510?
Yes, CoreyChem provides custom synthesis services for B 1510 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.