Poricoic acid B
TL;DR: Poricoic acid B (CAS 137551-39-4) is a chemical compound with molecular formula C30H44O5 and molecular weight 484.31888 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid
Also Known As: Poricoic acid B, 2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid, 2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-1H,2H,3H,4H,7H,8H-cyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid, 2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-Carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,6,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid, 2-[6-(2-Carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,6,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid
Technical Specifications
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.31888 g/mol |
| XLogP | 5.9 |
| Topological Polar Surface Area (TPSA) | 94.8 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 484.31888 Da |
| Heavy Atoms | 35 |
| Complexity | 983.0 |
| SMILES | CC(=CCCC([C@H]1[C@@H](C[C@@]2([C@@]1(CC=C3C2=CC[C@H]([C@]3(C)CCC(=O)O)C(=C)C)C)C)O)C(=O)O)C |
| InChIKey | NXAZWYWJZDFISF-RWENVMIDSA-N |
Chemical Property Profile of Poricoic acid B
Property Insights of Poricoic acid B
The XLogP value of 5.9 indicates that Poricoic acid B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 94.8 Ų falls within the moderate polarity range, balancing permeability and solubility for Poricoic acid B. Following Lipinski's Rule of Five, Poricoic acid B has 3 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Poricoic acid B?
The CAS number of Poricoic acid B is 137551-39-4.
What is the molecular formula of Poricoic acid B?
The molecular formula of Poricoic acid B is C30H44O5.
What is the molecular weight of Poricoic acid B?
The molecular weight of Poricoic acid B is 484.31888 g/mol.
Where can I buy Poricoic acid B?
You can request a quote for Poricoic acid B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Poricoic acid B?
Yes, CoreyChem provides custom synthesis services for Poricoic acid B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.