Fluoroindolocarbazole B
TL;DR: Fluoroindolocarbazole B (CAS 138829-47-7) is a chemical compound with molecular formula C26H19F2N3O7 and molecular weight 523.1191 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
6,20-difluoro-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione
Also Known As: Fluoroindolocarbazole B, J1.457.878A, 2,10-Difluoro-12,13-dihydro-12-[beta-D-glucopyranosyl]-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione, 2,10-Difluoro-12,13-dihydro-12-beta-D-glucopyranosyl-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione, 6,20-difluoro-23-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17(22),18,20-nonaene-12,14-dione
Technical Specifications
| Molecular Formula | C26H19F2N3O7 |
| Molecular Weight | 523.1191 g/mol |
| XLogP | 1.6 |
| Topological Polar Surface Area (TPSA) | 157.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Exact Mass | 523.1191 Da |
| Heavy Atoms | 38 |
| Complexity | 992.0 |
| SMILES | C1=CC2=C(C=C1F)NC3=C4C(=C5C(=C23)C(=O)NC5=O)C6=C(N4[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C=C(C=C6)F |
| InChIKey | NKNQTGRKBYNURK-QCUUGYDUSA-N |
Chemical Property Profile of Fluoroindolocarbazole B
Property Insights of Fluoroindolocarbazole B
The XLogP value of 1.6 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Fluoroindolocarbazole B. The TPSA of 157.0 Ų indicates high polarity, suggesting Fluoroindolocarbazole B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Fluoroindolocarbazole B has 6 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Fluoroindolocarbazole B?
The CAS number of Fluoroindolocarbazole B is 138829-47-7.
What is the molecular formula of Fluoroindolocarbazole B?
The molecular formula of Fluoroindolocarbazole B is C26H19F2N3O7.
What is the molecular weight of Fluoroindolocarbazole B?
The molecular weight of Fluoroindolocarbazole B is 523.1191 g/mol.
Where can I buy Fluoroindolocarbazole B?
You can request a quote for Fluoroindolocarbazole B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Fluoroindolocarbazole B?
Yes, CoreyChem provides custom synthesis services for Fluoroindolocarbazole B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.