Xeatobergsterol B
TL;DR: Xeatobergsterol B (CAS 141272-44-8) is a chemical compound with molecular formula C27H44O7 and molecular weight 480.30872 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(2R,4S,5R,7R,8S,9R,13R,14S,15R,16S,18S,19R,20R)-5,14,15,16,19,20-hexahydroxy-7,9,13-trimethyl-5-(2-methylpropyl)pentacyclo[10.8.0.02,9.04,8.013,18]icosan-3-one
Also Known As: Xeatobergsterol B, Xestobergsterol B, KST-1A1394, hexahydroxy-isobutyl-trimethyl-[?]one, (1
Technical Specifications
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.30872 g/mol |
| XLogP | 1.6 |
| Topological Polar Surface Area (TPSA) | 138.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Exact Mass | 480.30872 Da |
| Heavy Atoms | 34 |
| Complexity | 847.0 |
| SMILES | C[C@@H]1C[C@@]([C@@H]2[C@H]1[C@]3(CCC4C([C@H]3C2=O)[C@H]([C@@H]([C@@H]5[C@@]4([C@@H]([C@@H]([C@H](C5)O)O)O)C)O)O)C)(CC(C)C)O |
| InChIKey | DGXRPSIAVFYMOL-NFUSMCCKSA-N |
Chemical Property Profile of Xeatobergsterol B
Property Insights of Xeatobergsterol B
The XLogP value of 1.6 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Xeatobergsterol B. The TPSA of 138.0 Ų falls within the moderate polarity range, balancing permeability and solubility for Xeatobergsterol B. Following Lipinski's Rule of Five, Xeatobergsterol B has 6 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Xeatobergsterol B?
The CAS number of Xeatobergsterol B is 141272-44-8.
What is the molecular formula of Xeatobergsterol B?
The molecular formula of Xeatobergsterol B is C27H44O7.
What is the molecular weight of Xeatobergsterol B?
The molecular weight of Xeatobergsterol B is 480.30872 g/mol.
Where can I buy Xeatobergsterol B?
You can request a quote for Xeatobergsterol B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Xeatobergsterol B?
Yes, CoreyChem provides custom synthesis services for Xeatobergsterol B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.