Rhodamine B octadecyl ester perchlorate
TL;DR: Rhodamine B octadecyl ester perchlorate (CAS 142179-00-8) is a chemical compound with molecular formula C18H22ClNO3 and molecular weight 335.1288 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(4S,4aR,7S,12bS)-9-methoxy-3-methyl-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol chloride
Also Known As: Rhodamine B octadecyl ester perchlorate
Technical Specifications
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.1288 g/mol |
| XLogP | -2.91 |
| Topological Polar Surface Area (TPSA) | 43.1 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 335.1288 Da |
| Heavy Atoms | 23 |
| Complexity | 509.0 |
| SMILES | C[NH+]1CC[C@]23[C@@H]4[C@@H]1CC5=C2C(=C(C=C5)OC)OC3[C@H](C=C4)O.[Cl-] |
| InChIKey | NUXLENPAZQNFAM-SBXIDMTHSA-N |
Chemical Property Profile of Rhodamine B octadecyl ester perchlorate
Property Insights of Rhodamine B octadecyl ester perchlorate
The XLogP value of -2.91 indicates that Rhodamine B octadecyl ester perchlorate is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. With a topological polar surface area (TPSA) of 43.1 Ų, Rhodamine B octadecyl ester perchlorate exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Rhodamine B octadecyl ester perchlorate has 2 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Rhodamine B octadecyl ester perchlorate?
The CAS number of Rhodamine B octadecyl ester perchlorate is 142179-00-8.
What is the molecular formula of Rhodamine B octadecyl ester perchlorate?
The molecular formula of Rhodamine B octadecyl ester perchlorate is C18H22ClNO3.
What is the molecular weight of Rhodamine B octadecyl ester perchlorate?
The molecular weight of Rhodamine B octadecyl ester perchlorate is 335.1288 g/mol.
Where can I buy Rhodamine B octadecyl ester perchlorate?
You can request a quote for Rhodamine B octadecyl ester perchlorate directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Rhodamine B octadecyl ester perchlorate?
Yes, CoreyChem provides custom synthesis services for Rhodamine B octadecyl ester perchlorate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.