Kihadalactone B
TL;DR: Kihadalactone B (CAS 142546-00-7) is a chemical compound with molecular formula C30H42O8 and molecular weight 530.28796 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
[(2R,11R)-3-acetyloxy-2,7,7,11,16-pentamethyl-5-oxo-15-[(3S)-5-oxooxolan-3-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate
Also Known As: Kihadalactone B, NCI60_018593, ((2R,11R)-3-acetyloxy-2,7,7,11,16-pentamethyl-5-oxo-15-((3S)-5-oxooxolan-3-yl)-6-oxatetracyclo(9.7.0.02,8.012,16)octadec-12-en-10-yl) acetate, [(2R,11R)-3-acetyloxy-2,7,7,11,16-pentamethyl-5-oxo-15-[(3S)-5-oxooxolan-3-yl]-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate
Technical Specifications
| Molecular Formula | C30H42O8 |
| Molecular Weight | 530.28796 g/mol |
| XLogP | 4.3 |
| Topological Polar Surface Area (TPSA) | 105.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Exact Mass | 530.28796 Da |
| Heavy Atoms | 38 |
| Complexity | 1090.0 |
| SMILES | CC(=O)OC1CC2[C@@](C3[C@@]1(C4=CCC(C4(CC3)C)[C@@H]5CC(=O)OC5)C)(C(CC(=O)OC2(C)C)OC(=O)C)C |
| InChIKey | HJPHEKIKOJMFTJ-YPZQBJONSA-N |
Chemical Property Profile of Kihadalactone B
Property Insights of Kihadalactone B
The XLogP value of 4.3 indicates that Kihadalactone B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 105.0 Ų falls within the moderate polarity range, balancing permeability and solubility for Kihadalactone B. Following Lipinski's Rule of Five, Kihadalactone B has 0 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Kihadalactone B?
The CAS number of Kihadalactone B is 142546-00-7.
What is the molecular formula of Kihadalactone B?
The molecular formula of Kihadalactone B is C30H42O8.
What is the molecular weight of Kihadalactone B?
The molecular weight of Kihadalactone B is 530.28796 g/mol.
Where can I buy Kihadalactone B?
You can request a quote for Kihadalactone B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Kihadalactone B?
Yes, CoreyChem provides custom synthesis services for Kihadalactone B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.