Phosmidosine B
TL;DR: Phosmidosine B (CAS 146425-23-2) is a chemical compound with molecular formula C15H22N7O8P and molecular weight 459.12674 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-pyrrolidine-2-carbonyl]phosphonamidic acid
Also Known As: Phosmidosine B, Phosmidosine A, HY-N14658, J1.384.742H, [(2R,3S,4R,5R)-5-(6-Amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-pyrrolidine-2-carbonyl]phosphonamidic acid
Technical Specifications
| Molecular Formula | C15H22N7O8P |
| Molecular Weight | 459.12674 g/mol |
| XLogP | -6.3 |
| Topological Polar Surface Area (TPSA) | 221.0 Ų |
| Hydrogen Bond Donors | 7 |
| Hydrogen Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Exact Mass | 459.12674 Da |
| Heavy Atoms | 31 |
| Complexity | 761.0 |
| SMILES | C1C[C@H](NC1)C(=O)NP(=O)(O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C4=NC=NC(=C4NC3=O)N)O)O |
| InChIKey | SEHSCEYJWJDMSC-XLZJSAHRSA-N |
Chemical Property Profile of Phosmidosine B
Property Insights of Phosmidosine B
The XLogP value of -6.3 indicates that Phosmidosine B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 221.0 Ų indicates high polarity, suggesting Phosmidosine B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Phosmidosine B has 7 hydrogen bond donor(s) and 12 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Phosmidosine B?
The CAS number of Phosmidosine B is 146425-23-2.
What is the molecular formula of Phosmidosine B?
The molecular formula of Phosmidosine B is C15H22N7O8P.
What is the molecular weight of Phosmidosine B?
The molecular weight of Phosmidosine B is 459.12674 g/mol.
Where can I buy Phosmidosine B?
You can request a quote for Phosmidosine B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Phosmidosine B?
Yes, CoreyChem provides custom synthesis services for Phosmidosine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.