![HBcAg [Hepatitis B virus] (18-27) structure](/static/products/1478/147820-47-1.webp)
HBcAg [Hepatitis B virus] (18-27)
TL;DR: HBcAg [Hepatitis B virus] (18-27) (CAS 147820-47-1) is a chemical compound with molecular formula C58H78N10O15 and molecular weight 1154.5648 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxypropanoyl]amino]-3-methylbutanoic acid
Also Known As: HBV Seq1 aa:18-27, HY-P4050, HBcAg [Hepatitis B virus] (18-27), J1.215.769J, (2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxypropanoyl]amino]-4-hydroxy-4-oxobutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxypropanoyl]amino]-3-methylbutanoic acid
Technical Specifications
| Molecular Formula | C58H78N10O15 |
| Molecular Weight | 1154.5648 g/mol |
| XLogP | -0.6 |
| Topological Polar Surface Area (TPSA) | 385.0 Ų |
| Hydrogen Bond Donors | 12 |
| Hydrogen Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Exact Mass | 1154.5648 Da |
| Heavy Atoms | 83 |
| Complexity | 2230.0 |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)[C@H](CC5=CC=CC=C5)N |
| InChIKey | WPDJAEURSVPNPM-HKFFZEPVSA-N |
Chemical Property Profile of HBcAg [Hepatitis B virus] (18-27)
Property Insights of HBcAg [Hepatitis B virus] (18-27)
The XLogP value of -0.6 indicates that HBcAg [Hepatitis B virus] (18-27) is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 385.0 Ų indicates high polarity, suggesting HBcAg [Hepatitis B virus] (18-27) may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, HBcAg [Hepatitis B virus] (18-27) has 12 hydrogen bond donor(s) and 16 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of HBcAg [Hepatitis B virus] (18-27)?
The CAS number of HBcAg [Hepatitis B virus] (18-27) is 147820-47-1.
What is the molecular formula of HBcAg [Hepatitis B virus] (18-27)?
The molecular formula of HBcAg [Hepatitis B virus] (18-27) is C58H78N10O15.
What is the molecular weight of HBcAg [Hepatitis B virus] (18-27)?
The molecular weight of HBcAg [Hepatitis B virus] (18-27) is 1154.5648 g/mol.
Where can I buy HBcAg [Hepatitis B virus] (18-27)?
You can request a quote for HBcAg [Hepatitis B virus] (18-27) directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for HBcAg [Hepatitis B virus] (18-27)?
Yes, CoreyChem provides custom synthesis services for HBcAg [Hepatitis B virus] (18-27) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.