4-Deoxysiastatin B
TL;DR: 4-Deoxysiastatin B (CAS 148112-84-9) is a chemical compound with molecular formula C8H14N2O4 and molecular weight 202.09535 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(3R,5S,6R)-6-acetamido-5-hydroxypiperidine-3-carboxylic acid
Also Known As: 4-Deoxysiastatin B, (3R,5S,6R)-6-acetamido-5-hydroxypiperidine-3-carboxylic acid, 3-Piperidinecarboxylicacid,6- -5-hydroxy-,[3R- ]-, (3R)-6beta-Acetylamino-5alpha-hydroxypiperidine-3alpha-carboxylic acid, 3-Piperidinecarboxylic acid, 6-(acetylamino)-5-hydroxy-, (3R-(3alpha,5alpha,6beta))-
Technical Specifications
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.09535 g/mol |
| XLogP | -4.0 |
| Topological Polar Surface Area (TPSA) | 98.7 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 202.09535 Da |
| Heavy Atoms | 14 |
| Complexity | 243.0 |
| SMILES | CC(=O)N[C@@H]1[C@H](C[C@H](CN1)C(=O)O)O |
| InChIKey | HSRHUOVPONIGIS-DSYKOEDSSA-N |
Chemical Property Profile of 4-Deoxysiastatin B
Property Insights of 4-Deoxysiastatin B
The XLogP value of -4.0 indicates that 4-Deoxysiastatin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 98.7 Ų falls within the moderate polarity range, balancing permeability and solubility for 4-Deoxysiastatin B. Following Lipinski's Rule of Five, 4-Deoxysiastatin B has 4 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of 4-Deoxysiastatin B?
The CAS number of 4-Deoxysiastatin B is 148112-84-9.
What is the molecular formula of 4-Deoxysiastatin B?
The molecular formula of 4-Deoxysiastatin B is C8H14N2O4.
What is the molecular weight of 4-Deoxysiastatin B?
The molecular weight of 4-Deoxysiastatin B is 202.09535 g/mol.
Where can I buy 4-Deoxysiastatin B?
You can request a quote for 4-Deoxysiastatin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for 4-Deoxysiastatin B?
Yes, CoreyChem provides custom synthesis services for 4-Deoxysiastatin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.