Bungeiside B
TL;DR: Bungeiside B (CAS 149561-88-6) is a chemical compound with molecular formula C14H18O8 and molecular weight 314.10016 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
1-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone
Also Known As: Bungeiside B, Bungeiside-B, Cynanoneside B, 2-O-Glucosyl-4-hydroxyacetophenone, (2-Acetyl-5-hydroxyphenyl)beta-D-glucopyranoside
Technical Specifications
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.10016 g/mol |
| XLogP | -1.7 |
| Topological Polar Surface Area (TPSA) | 137.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Exact Mass | 314.10016 Da |
| Heavy Atoms | 22 |
| Complexity | 389.0 |
| SMILES | CC(=O)C1=C(C=C(C=C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| InChIKey | UEIZKRYEGCOJBJ-RKQHYHRCSA-N |
Chemical Property Profile of Bungeiside B
Property Insights of Bungeiside B
The XLogP value of -1.7 indicates that Bungeiside B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 137.0 Ų falls within the moderate polarity range, balancing permeability and solubility for Bungeiside B. Following Lipinski's Rule of Five, Bungeiside B has 5 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Bungeiside B?
The CAS number of Bungeiside B is 149561-88-6.
What is the molecular formula of Bungeiside B?
The molecular formula of Bungeiside B is C14H18O8.
What is the molecular weight of Bungeiside B?
The molecular weight of Bungeiside B is 314.10016 g/mol.
Where can I buy Bungeiside B?
You can request a quote for Bungeiside B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Bungeiside B?
Yes, CoreyChem provides custom synthesis services for Bungeiside B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.