Pseudolarolide B
TL;DR: Pseudolarolide B (CAS 151368-43-3) is a chemical compound with molecular formula C30H42O4 and molecular weight 466.30832 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
3',4,6,12,17,17-hexamethylspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,5'-furan]-2',18-dione
Also Known As: Pseudolarolide B, (1S,4R,5R,6R,8S,10R,12S,13S,16R,21R)-3',4,6,12,17,17-hexamethylspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,5'-furan]-2',18-dione
Technical Specifications
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.30832 g/mol |
| XLogP | 6.6 |
| Topological Polar Surface Area (TPSA) | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 466.30832 Da |
| Heavy Atoms | 34 |
| Complexity | 1040.0 |
| SMILES | CC1CC2(C=C(C(=O)O2)C)OC3C1C4(CCC56CC57CCC(=O)C(C7CCC6C4(C3)C)(C)C)C |
| InChIKey | ULWBDUNMGKITLY-UHFFFAOYSA-N |
Chemical Property Profile of Pseudolarolide B
Property Insights of Pseudolarolide B
The XLogP value of 6.6 indicates that Pseudolarolide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 52.6 Ų, Pseudolarolide B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Pseudolarolide B has 0 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Pseudolarolide B?
The CAS number of Pseudolarolide B is 151368-43-3.
What is the molecular formula of Pseudolarolide B?
The molecular formula of Pseudolarolide B is C30H42O4.
What is the molecular weight of Pseudolarolide B?
The molecular weight of Pseudolarolide B is 466.30832 g/mol.
Where can I buy Pseudolarolide B?
You can request a quote for Pseudolarolide B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Pseudolarolide B?
Yes, CoreyChem provides custom synthesis services for Pseudolarolide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.