CYTOCHALASIN B
TL;DR: CYTOCHALASIN B (CAS 15145-42-3) is a chemical compound with molecular formula C29H37NO5 and molecular weight 479.26718 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
(4Z,12E)-19-benzyl-6,15-dihydroxy-10,17-dimethyl-16-methylidene-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione
Also Known As: CYTOCHALASIN B, Phomin, EINECS 239-000-2, benzyl-dihydroxy-dimethyl-methylene-[?]dione, 16-benzyl-5,13-dihydroxy-9,15-dimethyl-14-methylidene-6,7,8,9,10,12a,13,14,15,15a,16,17-dodecahydro-2h-oxacyclotetradecino[2,3-d]isoindole-2,18(5h)-dione
Technical Specifications
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.26718 g/mol |
| XLogP | 3.4 |
| Topological Polar Surface Area (TPSA) | 95.9 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 479.26718 Da |
| Heavy Atoms | 35 |
| Complexity | 859.0 |
| SMILES | CC1CCCC(/C=C\C(=O)OC23C(/C=C/C1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O |
| InChIKey | GBOGMAARMMDZGR-CBKGHXGGSA-N |
Chemical Property Profile of CYTOCHALASIN B
Property Insights of CYTOCHALASIN B
The XLogP value of 3.4 indicates that CYTOCHALASIN B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 95.9 Ų falls within the moderate polarity range, balancing permeability and solubility for CYTOCHALASIN B. Following Lipinski's Rule of Five, CYTOCHALASIN B has 3 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of CYTOCHALASIN B?
The CAS number of CYTOCHALASIN B is 15145-42-3.
What is the molecular formula of CYTOCHALASIN B?
The molecular formula of CYTOCHALASIN B is C29H37NO5.
What is the molecular weight of CYTOCHALASIN B?
The molecular weight of CYTOCHALASIN B is 479.26718 g/mol.
Where can I buy CYTOCHALASIN B?
You can request a quote for CYTOCHALASIN B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for CYTOCHALASIN B?
Yes, CoreyChem provides custom synthesis services for CYTOCHALASIN B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.