Veranisatin B
TL;DR: Veranisatin B (CAS 153445-93-3) is a chemical compound with molecular formula C16H20O9 and molecular weight 356.11072 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
methyl 5,7,11-trihydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate
Also Known As: Veranisatin B, methyl 5,7,11-trihydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate, Methyl (1R-(1alpha,4beta,5beta,6beta,6abeta,9alpha,9abeta))-octahydro-1,5,6a-trihydroxy-9-methyl-2,2'-dioxospiro(6H-4,9a-methanocyclopent(d)oxocin-6,3'-oxetane)-5-carboxylate, Methyl octahydro-1,5,6a-trihydroxy-9-methyl-2,2'-dioxospiro(6H-4,9a-methanocyclopent(d)oxocin-6,3'-oxetane)-5-carboxylate (1R-(1alpha,4beta,5beta,6beta,6abeta,9alpha,9abeta))-, Spiro(6H,4,9a-methanocyclopent(d)oxocin-6,3'-oxetane)-5-carboxylic acid, octahydro-1,5,6a-trihydroxy-9-methyl-2,2'-dioxo-, methyl ester, (1R-(1alpha,4beta,5beta,6beta,6abeta,9alpha,9abeta))-
Technical Specifications
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.11072 g/mol |
| XLogP | -1.4 |
| Topological Polar Surface Area (TPSA) | 140.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Exact Mass | 356.11072 Da |
| Heavy Atoms | 25 |
| Complexity | 691.0 |
| Melting Point | 212 - 213 °C |
| SMILES | CC1CCC2(C13CC(C(C24COC4=O)(C(=O)OC)O)OC(=O)C3O)O |
| InChIKey | BPDHZCGFGOWILW-UHFFFAOYSA-N |
Chemical Property Profile of Veranisatin B
Property Insights of Veranisatin B
The XLogP value of -1.4 indicates that Veranisatin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 140.0 Ų indicates high polarity, suggesting Veranisatin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Veranisatin B has 3 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
What is the CAS number of Veranisatin B?
The CAS number of Veranisatin B is 153445-93-3.
What is the molecular formula of Veranisatin B?
The molecular formula of Veranisatin B is C16H20O9.
What is the molecular weight of Veranisatin B?
The molecular weight of Veranisatin B is 356.11072 g/mol.
Where can I buy Veranisatin B?
You can request a quote for Veranisatin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Veranisatin B?
Yes, CoreyChem provides custom synthesis services for Veranisatin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.